C8H12F7NO — CID 55092918
2-(2,2,3,3-tetrafluoropropoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 55092918) has the molecular formula C8H12F7NO and a molecular weight of 271.18 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 55092918 |
| Molecular Formula | C8H12F7NO |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CC(CNCC(F)(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F7NO/c1-5(2-16-3-8(13,14)15)17-4-7(11,12)6(9)10/h5-6,16H,2-4H2,1H3 |
| InChIKey | IYAAERSJCZOTFV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|