C12H23F4NO — CID 55092962
5-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]hexan-2-amine (PubChem CID 55092962) has the molecular formula C12H23F4NO and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]hexan-2-amine.
| Compound Name | 5-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]hexan-2-amine |
|---|---|
| PubChem CID | 55092962 |
| Molecular Formula | C12H23F4NO |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]hexan-2-amine |
| SMILES | CC(C)CCC(C)NCCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H23F4NO/c1-9(2)4-5-10(3)17-6-7-18-8-12(15,16)11(13)14/h9-11,17H,4-8H2,1-3H3 |
| InChIKey | SJWHJVULQNFPKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|