C13H19F3N2O — CID 55093466
N-methyl-1-(3-methyl-2-pyridinyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 55093466) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-2-pyridinyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | N-methyl-1-(3-methyl-2-pyridinyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 55093466 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-methyl-1-(3-methyl-2-pyridinyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | CNC(CCCOCC(F)(F)F)c1ncccc1C |
| InChI | InChI=1S/C13H19F3N2O/c1-10-5-3-7-18-12(10)11(17-2)6-4-8-19-9-13(14,15)16/h3,5,7,11,17H,4,6,8-9H2,1-2H3 |
| InChIKey | YHMOUNZEWQCCNG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|