C16H32N2S — CID 55094286
N,4-diethyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-amine (PubChem CID 55094286) has the molecular formula C16H32N2S and a molecular weight of 284.51 g/mol. Its IUPAC name is N,4-diethyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-amine.
| Compound Name | N,4-diethyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 55094286 |
| Molecular Formula | C16H32N2S |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N,4-diethyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1CN1CCCSCC1 |
| InChI | InChI=1S/C16H32N2S/c1-3-14-6-7-16(17-4-2)15(12-14)13-18-8-5-10-19-11-9-18/h14-17H,3-13H2,1-2H3 |
| InChIKey | HONGDYUCQLYDGW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |