C12H18FNO2S — CID 55095130
1-(2-fluorophenyl)-N-methyl-4-methylsulfonylbutan-2-amine (PubChem CID 55095130) has the molecular formula C12H18FNO2S and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-methyl-4-methylsulfonylbutan-2-amine.
| Compound Name | 1-(2-fluorophenyl)-N-methyl-4-methylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 55095130 |
| Molecular Formula | C12H18FNO2S |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(2-fluorophenyl)-N-methyl-4-methylsulfonylbutan-2-amine |
| SMILES | CNC(CCS(C)(=O)=O)Cc1ccccc1F |
| InChI | InChI=1S/C12H18FNO2S/c1-14-11(7-8-17(2,15)16)9-10-5-3-4-6-12(10)13/h3-6,11,14H,7-9H2,1-2H3 |
| InChIKey | CDIUNICRBWZRIX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |