C10H17F6NO — CID 55095420
1,1,1-trifluoro-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-3-amine (PubChem CID 55095420) has the molecular formula C10H17F6NO and a molecular weight of 281.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-3-amine.
| Compound Name | 1,1,1-trifluoro-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-3-amine |
|---|---|
| PubChem CID | 55095420 |
| Molecular Formula | C10H17F6NO |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1,1,1-trifluoro-N-propyl-5-(2,2,2-trifluoroethoxy)pentan-3-amine |
| SMILES | CCCNC(CCOCC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C10H17F6NO/c1-2-4-17-8(6-9(11,12)13)3-5-18-7-10(14,15)16/h8,17H,2-7H2,1H3 |
| InChIKey | SJSBYWOXSVYLMN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|