About 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine
2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine (PubChem CID 55095776) has the molecular formula C14H26F3NO
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine |
| PubChem CID | 55095776 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine |
| SMILES | CC(C)(C)C1CCCCC1(N)CCOCC(F)(F)F |
| InChI | InChI=1S/C14H26F3NO/c1-12(2,3)11-6-4-5-7-13(11,18)8-9-19-10-14(15,16)17/h11H,4-10,18H2,1-3H3 |
| InChIKey | SPVZQJXGJMGIIB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine?
The IUPAC name of 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine (CID 55095776) is 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine.
What is the SMILES notation for 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine?
The canonical SMILES for 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine is CC(C)(C)C1CCCCC1(N)CCOCC(F)(F)F.
What is the InChIKey of 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine?
The InChIKey is SPVZQJXGJMGIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3NO/c1-12(2,3)11-6-4-5-7-13(11,18)8-9-19-10-14(15,16)17/h11H,4-10,18H2,1-3H3.
What are the key properties of 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine?
2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine has a molecular weight of 281.36 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-amine is sourced from PubChem (CID 55095776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).