C16H17ClO — CID 55096467
1-(3-chlorophenyl)-4-phenylbutan-1-ol (PubChem CID 55096467) has the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-phenylbutan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 55096467 |
| Molecular Formula | C16H17ClO |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(3-chlorophenyl)-4-phenylbutan-1-ol |
| SMILES | OC(CCCc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClO/c17-15-10-5-9-14(12-15)16(18)11-4-8-13-6-2-1-3-7-13/h1-3,5-7,9-10,12,16,18H,4,8,11H2 |
| InChIKey | CKMZQYVAEJRIBJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |