C16H27ClN2 — CID 55099013
1-(2-chlorophenyl)-N,N'-dimethyl-N'-pentylpropane-1,3-diamine (PubChem CID 55099013) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,N'-dimethyl-N'-pentylpropane-1,3-diamine.
| Compound Name | 1-(2-chlorophenyl)-N,N'-dimethyl-N'-pentylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55099013 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(2-chlorophenyl)-N,N'-dimethyl-N'-pentylpropane-1,3-diamine |
| SMILES | CCCCCN(C)CCC(NC)c1ccccc1Cl |
| InChI | InChI=1S/C16H27ClN2/c1-4-5-8-12-19(3)13-11-16(18-2)14-9-6-7-10-15(14)17/h6-7,9-10,16,18H,4-5,8,11-13H2,1-3H3 |
| InChIKey | PDQYTXPNIMARBH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|