C13H9F2N3 — CID 55100100
2-(2,3-difluorophenyl)-3H-benzimidazol-5-amine (PubChem CID 55100100) has the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(2,3-difluorophenyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 55100100 |
| Molecular Formula | C13H9F2N3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-(2,3-difluorophenyl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(-c3cccc(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C13H9F2N3/c14-9-3-1-2-8(12(9)15)13-17-10-5-4-7(16)6-11(10)18-13/h1-6H,16H2,(H,17,18) |
| InChIKey | JWAFKPFFXHIMMK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|