C15H26N2 — CID 55101555
3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentanenitrile (PubChem CID 55101555) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentanenitrile.
| Compound Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentanenitrile |
|---|---|
| PubChem CID | 55101555 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pentanenitrile |
| SMILES | CCC(CC#N)NC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C15H26N2/c1-2-14(9-10-16)17-15-8-7-12-5-3-4-6-13(12)11-15/h12-15,17H,2-9,11H2,1H3 |
| InChIKey | IWXISXPBWQFNKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |