C14H9BrF2O2 — CID 55101814
(3-bromo-4-methoxyphenyl)-(2,3-difluorophenyl)methanone (PubChem CID 55101814) has the molecular formula C14H9BrF2O2 and a molecular weight of 327.12 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)-(2,3-difluorophenyl)methanone.
| Compound Name | (3-bromo-4-methoxyphenyl)-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 55101814 |
| Molecular Formula | C14H9BrF2O2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)-(2,3-difluorophenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cccc(F)c2F)cc1Br |
| InChI | InChI=1S/C14H9BrF2O2/c1-19-12-6-5-8(7-10(12)15)14(18)9-3-2-4-11(16)13(9)17/h2-7H,1H3 |
| InChIKey | IROOOYDYPCODQX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |