C9H10N2O4S2 — CID 55102481
5-(2-cyanoethylsulfamoyl)-3-methylthiophene-2-carboxylic acid (PubChem CID 55102481) has the molecular formula C9H10N2O4S2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-(2-cyanoethylsulfamoyl)-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(2-cyanoethylsulfamoyl)-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 55102481 |
| Molecular Formula | C9H10N2O4S2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5-(2-cyanoethylsulfamoyl)-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)NCCC#N)sc1C(=O)O |
| InChI | InChI=1S/C9H10N2O4S2/c1-6-5-7(16-8(6)9(12)13)17(14,15)11-4-2-3-10/h5,11H,2,4H2,1H3,(H,12,13) |
| InChIKey | JFJOJYJLUFEUFX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|