C14H20BrNO — CID 55102721
N-[(2-bromophenyl)methyl]-N,2,2-trimethylbutanamide (PubChem CID 55102721) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N,2,2-trimethylbutanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 55102721 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C14H20BrNO/c1-5-14(2,3)13(17)16(4)10-11-8-6-7-9-12(11)15/h6-9H,5,10H2,1-4H3 |
| InChIKey | FFVILQSIEAONGE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |