About 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one
5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one (PubChem CID 55103305) has the molecular formula C15H21BrN2O
and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one |
| PubChem CID | 55103305 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one |
| SMILES | CCC(C)(C)C(Br)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H21BrN2O/c1-6-15(2,3)13(16)10-7-8-11-12(9-10)18(5)14(19)17(11)4/h7-9,13H,6H2,1-5H3 |
| InChIKey | VTIMOVPTCNJEIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one?
The IUPAC name of 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one (CID 55103305) is 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one.
What is the SMILES notation for 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one?
The canonical SMILES for 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one is CCC(C)(C)C(Br)c1ccc2c(c1)n(C)c(=O)n2C.
What is the InChIKey of 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one?
The InChIKey is VTIMOVPTCNJEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN2O/c1-6-15(2,3)13(16)10-7-8-11-12(9-10)18(5)14(19)17(11)4/h7-9,13H,6H2,1-5H3.
What are the key properties of 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one?
5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one has a molecular weight of 325.25 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-bromo-2,2-dimethylbutyl)-1,3-dimethylbenzimidazol-2-one is sourced from PubChem (CID 55103305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).