About 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine
1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine (PubChem CID 55103645) has the molecular formula C10H9N5O2
and a molecular weight of 231.22 g/mol. Its IUPAC name is 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine |
| PubChem CID | 55103645 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine |
| SMILES | Nc1cnn(Cc2nc(-c3ccco3)no2)c1 |
| InChI | InChI=1S/C10H9N5O2/c11-7-4-12-15(5-7)6-9-13-10(14-17-9)8-2-1-3-16-8/h1-5H,6,11H2 |
| InChIKey | XQIDCMLQSPCTRH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine?
The IUPAC name of 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine (CID 55103645) is 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine.
What is the SMILES notation for 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine?
The canonical SMILES for 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine is Nc1cnn(Cc2nc(-c3ccco3)no2)c1.
What is the InChIKey of 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine?
The InChIKey is XQIDCMLQSPCTRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O2/c11-7-4-12-15(5-7)6-9-13-10(14-17-9)8-2-1-3-16-8/h1-5H,6,11H2.
What are the key properties of 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine?
1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine has a molecular weight of 231.22 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrazol-4-amine is sourced from PubChem (CID 55103645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).