C13H11FN2O2S — CID 55106476
4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorobenzoic acid (PubChem CID 55106476) has the molecular formula C13H11FN2O2S and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorobenzoic acid.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 55106476 |
| Molecular Formula | C13H11FN2O2S |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorobenzoic acid |
| SMILES | Cc1cc(C)nc(Sc2ccc(C(=O)O)cc2F)n1 |
| InChI | InChI=1S/C13H11FN2O2S/c1-7-5-8(2)16-13(15-7)19-11-4-3-9(12(17)18)6-10(11)14/h3-6H,1-2H3,(H,17,18) |
| InChIKey | YJXXJVQKYKAPEL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |