About N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine
N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 55106953) has the molecular formula C14H17Cl3N2
and a molecular weight of 319.66 g/mol. Its IUPAC name is N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine.
Molecular Properties
| Compound Name | N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine |
| PubChem CID | 55106953 |
| Molecular Formula | C14H17Cl3N2 |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CNC1CC2CCC(C1)N2c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl3N2/c1-18-8-4-9-2-3-10(5-8)19(9)14-7-12(16)11(15)6-13(14)17/h6-10,18H,2-5H2,1H3 |
| InChIKey | CDNNMFDNRCFGOU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine?
The IUPAC name of N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine (CID 55106953) is N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine.
What is the SMILES notation for N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine?
The canonical SMILES for N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine is CNC1CC2CCC(C1)N2c1cc(Cl)c(Cl)cc1Cl.
What is the InChIKey of N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine?
The InChIKey is CDNNMFDNRCFGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl3N2/c1-18-8-4-9-2-3-10(5-8)19(9)14-7-12(16)11(15)6-13(14)17/h6-10,18H,2-5H2,1H3.
What are the key properties of N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine?
N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine has a molecular weight of 319.66 g/mol, XLogP of 4.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-8-(2,4,5-trichlorophenyl)-8-azabicyclo[3.2.1]octan-3-amine is sourced from PubChem (CID 55106953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).