About 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine
1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine (PubChem CID 55107032) has the molecular formula C15H21NO2S
and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine |
| PubChem CID | 55107032 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine |
| SMILES | CNCC1(C2CS(=O)(=O)c3ccccc32)CCCC1 |
| InChI | InChI=1S/C15H21NO2S/c1-16-11-15(8-4-5-9-15)13-10-19(17,18)14-7-3-2-6-12(13)14/h2-3,6-7,13,16H,4-5,8-11H2,1H3 |
| InChIKey | PAOMONROOWRKEG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine?
The IUPAC name of 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine (CID 55107032) is 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine.
What is the SMILES notation for 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine?
The canonical SMILES for 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine is CNCC1(C2CS(=O)(=O)c3ccccc32)CCCC1.
What is the InChIKey of 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine?
The InChIKey is PAOMONROOWRKEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2S/c1-16-11-15(8-4-5-9-15)13-10-19(17,18)14-7-3-2-6-12(13)14/h2-3,6-7,13,16H,4-5,8-11H2,1H3.
What are the key properties of 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine?
1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine has a molecular weight of 279.40 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)cyclopentyl]-N-methylmethanamine is sourced from PubChem (CID 55107032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).