C11H19F3O3 — CID 55107113
2,2-diethyl-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 55107113) has the molecular formula C11H19F3O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2,2-diethyl-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2,2-diethyl-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 55107113 |
| Molecular Formula | C11H19F3O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,2-diethyl-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | CCC(CC)(CCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H19F3O3/c1-3-10(4-2,9(15)16)6-5-7-17-8-11(12,13)14/h3-8H2,1-2H3,(H,15,16) |
| InChIKey | RWMMIDZUIGWMTK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|