C11H13N5O3 — CID 55107302
2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-4-nitroaniline (PubChem CID 55107302) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-4-nitroaniline.
| Compound Name | 2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-4-nitroaniline |
|---|---|
| PubChem CID | 55107302 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-4-nitroaniline |
| SMILES | COCCn1cnnc1-c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C11H13N5O3/c1-19-5-4-15-7-13-14-11(15)9-6-8(16(17)18)2-3-10(9)12/h2-3,6-7H,4-5,12H2,1H3 |
| InChIKey | MJNPYRGTKPRAPD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|