C13H16N2O2 — CID 55107933
2-(prop-2-enylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylic acid (PubChem CID 55107933) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylic acid.
| Compound Name | 2-(prop-2-enylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 55107933 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-(prop-2-enylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylic acid |
| SMILES | C=CCNc1nc2c(cc1C(=O)O)CCCC2 |
| InChI | InChI=1S/C13H16N2O2/c1-2-7-14-12-10(13(16)17)8-9-5-3-4-6-11(9)15-12/h2,8H,1,3-7H2,(H,14,15)(H,16,17) |
| InChIKey | KIBOWJMFPCLINH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|