C12H9F2N3O2 — CID 55108025
3-[(2,4-difluorophenyl)methylamino]pyrazine-2-carboxylic acid (PubChem CID 55108025) has the molecular formula C12H9F2N3O2 and a molecular weight of 265.22 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[(2,4-difluorophenyl)methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 55108025 |
| Molecular Formula | C12H9F2N3O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylamino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C12H9F2N3O2/c13-8-2-1-7(9(14)5-8)6-17-11-10(12(18)19)15-3-4-16-11/h1-5H,6H2,(H,16,17)(H,18,19) |
| InChIKey | NAHWGOCGLHPKIS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |