2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid

C13H21N3O2 — CID 55108085

IUPAC2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid
SMILESCCn1cnnc1CC1(CC(=O)O)CCCCC1
InChIInChI=1S/C13H21N3O2/c1-2-16-10-14-15-11(16)8-13(9-12(17)18)6-4-3-5-7-13/h10H,2-9H2,1H3,(H,17,18)
InChIKeyLVKNQIVFESZIFW-UHFFFAOYSA-N
MW251.33 g/mol
LogP2.27
Rot. Bonds5

About 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid

2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid (PubChem CID 55108085) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid.

Molecular Properties

Compound Name2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid
PubChem CID55108085
Molecular FormulaC13H21N3O2
Molecular Weight251.33 g/mol
Exact Mass251.16
IUPAC Name2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid
SMILESCCn1cnnc1CC1(CC(=O)O)CCCCC1
InChIInChI=1S/C13H21N3O2/c1-2-16-10-14-15-11(16)8-13(9-12(17)18)6-4-3-5-7-13/h10H,2-9H2,1H3,(H,17,18)
InChIKeyLVKNQIVFESZIFW-UHFFFAOYSA-N
XLogP2.27
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid?
The IUPAC name of 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid (CID 55108085) is 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid.
What is the SMILES notation for 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid?
The canonical SMILES for 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid is CCn1cnnc1CC1(CC(=O)O)CCCCC1.
What is the InChIKey of 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid?
The InChIKey is LVKNQIVFESZIFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-2-16-10-14-15-11(16)8-13(9-12(17)18)6-4-3-5-7-13/h10H,2-9H2,1H3,(H,17,18).
What are the key properties of 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid?
2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid has a molecular weight of 251.33 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]cyclohexyl]acetic acid is sourced from PubChem (CID 55108085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).