C14H16N4 — CID 55108301
1-(pyrimidin-2-ylmethyl)-3,4-dihydro-2H-quinolin-5-amine (PubChem CID 55108301) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(pyrimidin-2-ylmethyl)-3,4-dihydro-2H-quinolin-5-amine.
| Compound Name | 1-(pyrimidin-2-ylmethyl)-3,4-dihydro-2H-quinolin-5-amine |
|---|---|
| PubChem CID | 55108301 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(pyrimidin-2-ylmethyl)-3,4-dihydro-2H-quinolin-5-amine |
| SMILES | Nc1cccc2c1CCCN2Cc1ncccn1 |
| InChI | InChI=1S/C14H16N4/c15-12-5-1-6-13-11(12)4-2-9-18(13)10-14-16-7-3-8-17-14/h1,3,5-8H,2,4,9-10,15H2 |
| InChIKey | BZTWILVSSGVVFV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|