About 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine
1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine (PubChem CID 55108617) has the molecular formula C11H23N3O2S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 55108617 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(C2CS(=O)(=O)CC2N)CC1 |
| InChI | InChI=1S/C11H23N3O2S/c1-13(2)9-3-5-14(6-4-9)11-8-17(15,16)7-10(11)12/h9-11H,3-8,12H2,1-2H3 |
| InChIKey | ASQPDFBOLXZGHA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine (CID 55108617) is 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine is CN(C)C1CCN(C2CS(=O)(=O)CC2N)CC1.
What is the InChIKey of 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine?
The InChIKey is ASQPDFBOLXZGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2S/c1-13(2)9-3-5-14(6-4-9)11-8-17(15,16)7-10(11)12/h9-11H,3-8,12H2,1-2H3.
What are the key properties of 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine?
1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine has a molecular weight of 261.39 g/mol, XLogP of -0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,1-dioxothiolan-3-yl)-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 55108617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).