C13H13ClN4O — CID 55109869
2-chloro-N-methyl-5-(pyrimidin-4-ylmethylamino)benzamide (PubChem CID 55109869) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-(pyrimidin-4-ylmethylamino)benzamide.
| Compound Name | 2-chloro-N-methyl-5-(pyrimidin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 55109869 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-chloro-N-methyl-5-(pyrimidin-4-ylmethylamino)benzamide |
| SMILES | CNC(=O)c1cc(NCc2ccncn2)ccc1Cl |
| InChI | InChI=1S/C13H13ClN4O/c1-15-13(19)11-6-9(2-3-12(11)14)17-7-10-4-5-16-8-18-10/h2-6,8,17H,7H2,1H3,(H,15,19) |
| InChIKey | GJJFZHCAHKOMBA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |