C12H10N4O2S — CID 55110287
5-(1,3-thiazol-5-ylmethylamino)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 55110287) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 5-(1,3-thiazol-5-ylmethylamino)-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 5-(1,3-thiazol-5-ylmethylamino)-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 55110287 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-(1,3-thiazol-5-ylmethylamino)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c(NCc3cncs3)cccc12 |
| InChI | InChI=1S/C12H10N4O2S/c17-11-8-2-1-3-9(10(8)12(18)16-15-11)14-5-7-4-13-6-19-7/h1-4,6,14H,5H2,(H,15,17)(H,16,18) |
| InChIKey | BFZNTWDGTURRSV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |