About 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid
5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid (PubChem CID 55111144) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid |
| PubChem CID | 55111144 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid |
| SMILES | CC(C)Cc1nc(CCCCC(=O)O)n(C)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-9(2)8-10-13-11(15(3)14-10)6-4-5-7-12(16)17/h9H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | UDVBGWWZFVKDCB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid?
The IUPAC name of 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid (CID 55111144) is 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid.
What is the SMILES notation for 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid?
The canonical SMILES for 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid is CC(C)Cc1nc(CCCCC(=O)O)n(C)n1.
What is the InChIKey of 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid?
The InChIKey is UDVBGWWZFVKDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-9(2)8-10-13-11(15(3)14-10)6-4-5-7-12(16)17/h9H,4-8H2,1-3H3,(H,16,17).
What are the key properties of 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid?
5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid has a molecular weight of 239.32 g/mol, XLogP of 1.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-methyl-5-(2-methylpropyl)-1,2,4-triazol-3-yl]pentanoic acid is sourced from PubChem (CID 55111144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).