C12H8F2N4S — CID 55111243
2,4-difluoro-5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 55111243) has the molecular formula C12H8F2N4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2,4-difluoro-5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2,4-difluoro-5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 55111243 |
| Molecular Formula | C12H8F2N4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2,4-difluoro-5-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Nc1cc(-c2n[nH]c(-c3cccs3)n2)c(F)cc1F |
| InChI | InChI=1S/C12H8F2N4S/c13-7-5-8(14)9(15)4-6(7)11-16-12(18-17-11)10-2-1-3-19-10/h1-5H,15H2,(H,16,17,18) |
| InChIKey | QZCFLTMNLNSOJU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|