C15H22N4 — CID 55111261
2-methyl-N-[3-(1-pyridin-2-ylpyrazol-4-yl)propyl]propan-1-amine (PubChem CID 55111261) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-methyl-N-[3-(1-pyridin-2-ylpyrazol-4-yl)propyl]propan-1-amine.
| Compound Name | 2-methyl-N-[3-(1-pyridin-2-ylpyrazol-4-yl)propyl]propan-1-amine |
|---|---|
| PubChem CID | 55111261 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-methyl-N-[3-(1-pyridin-2-ylpyrazol-4-yl)propyl]propan-1-amine |
| SMILES | CC(C)CNCCCc1cnn(-c2ccccn2)c1 |
| InChI | InChI=1S/C15H22N4/c1-13(2)10-16-8-5-6-14-11-18-19(12-14)15-7-3-4-9-17-15/h3-4,7,9,11-13,16H,5-6,8,10H2,1-2H3 |
| InChIKey | FUKSAWHPZWHACB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|