About phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol
phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol (PubChem CID 55111758) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol.
Molecular Properties
| Compound Name | phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol |
| PubChem CID | 55111758 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol |
| SMILES | OC(c1ccccc1)c1nc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C13H11N3OS/c17-11(9-5-2-1-3-6-9)13-14-12(15-16-13)10-7-4-8-18-10/h1-8,11,17H,(H,14,15,16) |
| InChIKey | VVTHQVJVPGKZGW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol?
The IUPAC name of phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol (CID 55111758) is phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol.
What is the SMILES notation for phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol?
The canonical SMILES for phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol is OC(c1ccccc1)c1nc(-c2cccs2)n[nH]1.
What is the InChIKey of phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol?
The InChIKey is VVTHQVJVPGKZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS/c17-11(9-5-2-1-3-6-9)13-14-12(15-16-13)10-7-4-8-18-10/h1-8,11,17H,(H,14,15,16).
What are the key properties of phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol?
phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol has a molecular weight of 257.32 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methanol is sourced from PubChem (CID 55111758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).