About 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine
3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine (PubChem CID 55111824) has the molecular formula C11H19N3O2S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine |
| PubChem CID | 55111824 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine |
| SMILES | CC1(n2cc(CCCN)cn2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19N3O2S/c1-11(4-6-17(15,16)9-11)14-8-10(7-13-14)3-2-5-12/h7-8H,2-6,9,12H2,1H3 |
| InChIKey | QKQDQZPPSWAJEO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine?
The IUPAC name of 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine (CID 55111824) is 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine.
What is the SMILES notation for 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine?
The canonical SMILES for 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine is CC1(n2cc(CCCN)cn2)CCS(=O)(=O)C1.
What is the InChIKey of 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine?
The InChIKey is QKQDQZPPSWAJEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2S/c1-11(4-6-17(15,16)9-11)14-8-10(7-13-14)3-2-5-12/h7-8H,2-6,9,12H2,1H3.
What are the key properties of 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine?
3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine has a molecular weight of 257.36 g/mol, XLogP of 0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazol-4-yl]propan-1-amine is sourced from PubChem (CID 55111824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).