C13H16N2OS — CID 55111939
[2-(N,3,5-trimethylanilino)-1,3-thiazol-5-yl]methanol (PubChem CID 55111939) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is [2-(N,3,5-trimethylanilino)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(N,3,5-trimethylanilino)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 55111939 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [2-(N,3,5-trimethylanilino)-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1cc(C)cc(N(C)c2ncc(CO)s2)c1 |
| InChI | InChI=1S/C13H16N2OS/c1-9-4-10(2)6-11(5-9)15(3)13-14-7-12(8-16)17-13/h4-7,16H,8H2,1-3H3 |
| InChIKey | ASVTYYXNYIUGRV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |