C15H26N2OS — CID 55112269
2-(dibutylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 55112269) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-(dibutylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-(dibutylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 55112269 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-(dibutylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | CCCCN(CCCC)c1nc2c(s1)C(O)CCC2 |
| InChI | InChI=1S/C15H26N2OS/c1-3-5-10-17(11-6-4-2)15-16-12-8-7-9-13(18)14(12)19-15/h13,18H,3-11H2,1-2H3 |
| InChIKey | VAZDITLICPUBBO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |