About 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol
1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol (PubChem CID 55112277) has the molecular formula C13H18N2O2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 55112277 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1nc(N(C)Cc2ccoc2C)sc1C(C)O |
| InChI | InChI=1S/C13H18N2O2S/c1-8-12(9(2)16)18-13(14-8)15(4)7-11-5-6-17-10(11)3/h5-6,9,16H,7H2,1-4H3 |
| InChIKey | HOFABWQZLQXATQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol (CID 55112277) is 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol is Cc1nc(N(C)Cc2ccoc2C)sc1C(C)O.
What is the InChIKey of 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol?
The InChIKey is HOFABWQZLQXATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S/c1-8-12(9(2)16)18-13(14-8)15(4)7-11-5-6-17-10(11)3/h5-6,9,16H,7H2,1-4H3.
What are the key properties of 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol?
1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol has a molecular weight of 266.37 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-methyl-2-[methyl-[(2-methylfuran-3-yl)methyl]amino]-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 55112277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).