C12H20F3N3S — CID 55112589
N-propyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine (PubChem CID 55112589) has the molecular formula C12H20F3N3S and a molecular weight of 295.37 g/mol. Its IUPAC name is N-propyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | N-propyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 55112589 |
| Molecular Formula | C12H20F3N3S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-propyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1cnc(N(CCC)CC(F)(F)F)s1 |
| InChI | InChI=1S/C12H20F3N3S/c1-3-5-16-7-10-8-17-11(19-10)18(6-4-2)9-12(13,14)15/h8,16H,3-7,9H2,1-2H3 |
| InChIKey | MCSZQOAIAWPVSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|