C12H17F3N2OS — CID 55113370
2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4-propyl-1,3-thiazole-5-carbaldehyde (PubChem CID 55113370) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4-propyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4-propyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 55113370 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-4-propyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCc1nc(N(CC(F)(F)F)C(C)C)sc1C=O |
| InChI | InChI=1S/C12H17F3N2OS/c1-4-5-9-10(6-18)19-11(16-9)17(8(2)3)7-12(13,14)15/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | HOALQXHZEIZWIW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|