C13H20F3N3 — CID 55114012
N-[2-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]ethyl]propan-1-amine (PubChem CID 55114012) has the molecular formula C13H20F3N3 and a molecular weight of 275.32 g/mol. Its IUPAC name is N-[2-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 55114012 |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[2-[4,6-dimethyl-2-(2,2,2-trifluoroethyl)pyrimidin-5-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1c(C)nc(CC(F)(F)F)nc1C |
| InChI | InChI=1S/C13H20F3N3/c1-4-6-17-7-5-11-9(2)18-12(19-10(11)3)8-13(14,15)16/h17H,4-8H2,1-3H3 |
| InChIKey | DCPTYWMMSLAMEW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|