C14H23N3O2 — CID 55114741
ethyl 4-[(5-methyl-1H-imidazol-4-yl)methylamino]cyclohexane-1-carboxylate (PubChem CID 55114741) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-1H-imidazol-4-yl)methylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(5-methyl-1H-imidazol-4-yl)methylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55114741 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | ethyl 4-[(5-methyl-1H-imidazol-4-yl)methylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NCc2nc[nH]c2C)CC1 |
| InChI | InChI=1S/C14H23N3O2/c1-3-19-14(18)11-4-6-12(7-5-11)15-8-13-10(2)16-9-17-13/h9,11-12,15H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | JJZINQCPWHSXRN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |