About 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine
4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine (PubChem CID 55115604) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine |
| PubChem CID | 55115604 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine |
| SMILES | Cc1ccc(S(=O)C2CCC(N)CC2)cc1C |
| InChI | InChI=1S/C14H21NOS/c1-10-3-6-14(9-11(10)2)17(16)13-7-4-12(15)5-8-13/h3,6,9,12-13H,4-5,7-8,15H2,1-2H3 |
| InChIKey | YXTUGFGUWVMULM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine?
The IUPAC name of 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine (CID 55115604) is 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine.
What is the SMILES notation for 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine?
The canonical SMILES for 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine is Cc1ccc(S(=O)C2CCC(N)CC2)cc1C.
What is the InChIKey of 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine?
The InChIKey is YXTUGFGUWVMULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-10-3-6-14(9-11(10)2)17(16)13-7-4-12(15)5-8-13/h3,6,9,12-13H,4-5,7-8,15H2,1-2H3.
What are the key properties of 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine?
4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine has a molecular weight of 251.39 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenyl)sulfinylcyclohexan-1-amine is sourced from PubChem (CID 55115604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).