About 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine
4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 55115772) has the molecular formula C12H12N4O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 55115772 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | COc1cc2nc(-c3csc(N)n3)[nH]c2cc1OC |
| InChI | InChI=1S/C12H12N4O2S/c1-17-9-3-6-7(4-10(9)18-2)15-11(14-6)8-5-19-12(13)16-8/h3-5H,1-2H3,(H2,13,16)(H,14,15) |
| InChIKey | WAPUMKKIMXLWIF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine (CID 55115772) is 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine is COc1cc2nc(-c3csc(N)n3)[nH]c2cc1OC.
What is the InChIKey of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine?
The InChIKey is WAPUMKKIMXLWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S/c1-17-9-3-6-7(4-10(9)18-2)15-11(14-6)8-5-19-12(13)16-8/h3-5H,1-2H3,(H2,13,16)(H,14,15).
What are the key properties of 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine?
4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine has a molecular weight of 276.32 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethoxy-1H-benzimidazol-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 55115772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).