C14H14ClNO2 — CID 55116184
1-(5-chloro-2-methoxyphenyl)-2-pyridin-4-ylethanol (PubChem CID 55116184) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2-pyridin-4-ylethanol.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 55116184 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2-pyridin-4-ylethanol |
| SMILES | COc1ccc(Cl)cc1C(O)Cc1ccncc1 |
| InChI | InChI=1S/C14H14ClNO2/c1-18-14-3-2-11(15)9-12(14)13(17)8-10-4-6-16-7-5-10/h2-7,9,13,17H,8H2,1H3 |
| InChIKey | DXMLGDYPSQSGLM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |