About N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine
N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 55117280) has the molecular formula C14H25N3OS
and a molecular weight of 283.44 g/mol. Its IUPAC name is N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 55117280 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N(C)CC2CCCO2)sc1CNC(C)C |
| InChI | InChI=1S/C14H25N3OS/c1-10(2)15-8-13-11(3)16-14(19-13)17(4)9-12-6-5-7-18-12/h10,12,15H,5-9H2,1-4H3 |
| InChIKey | PXIRUXQYAYZCJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine?
The IUPAC name of N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine (CID 55117280) is N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine is Cc1nc(N(C)CC2CCCO2)sc1CNC(C)C.
What is the InChIKey of N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine?
The InChIKey is PXIRUXQYAYZCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3OS/c1-10(2)15-8-13-11(3)16-14(19-13)17(4)9-12-6-5-7-18-12/h10,12,15H,5-9H2,1-4H3.
What are the key properties of N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine?
N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine has a molecular weight of 283.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-N-(oxolan-2-ylmethyl)-5-[(propan-2-ylamino)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 55117280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).