About 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine
5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine (PubChem CID 55117419) has the molecular formula C13H23N3OS
and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine |
| PubChem CID | 55117419 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine |
| SMILES | COCC(C)N(C)c1nc(C)c(CNC2CC2)s1 |
| InChI | InChI=1S/C13H23N3OS/c1-9(8-17-4)16(3)13-15-10(2)12(18-13)7-14-11-5-6-11/h9,11,14H,5-8H2,1-4H3 |
| InChIKey | HAROLOUPXNCPPB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine (CID 55117419) is 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine is COCC(C)N(C)c1nc(C)c(CNC2CC2)s1.
What is the InChIKey of 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine?
The InChIKey is HAROLOUPXNCPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3OS/c1-9(8-17-4)16(3)13-15-10(2)12(18-13)7-14-11-5-6-11/h9,11,14H,5-8H2,1-4H3.
What are the key properties of 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine?
5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine has a molecular weight of 269.41 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(cyclopropylamino)methyl]-N-(1-methoxypropan-2-yl)-N,4-dimethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 55117419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).