C12H23N3OS — CID 55117456
N,4-diethyl-5-[(2-methoxyethylamino)methyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 55117456) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is N,4-diethyl-5-[(2-methoxyethylamino)methyl]-N-methyl-1,3-thiazol-2-amine.
| Compound Name | N,4-diethyl-5-[(2-methoxyethylamino)methyl]-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 55117456 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N,4-diethyl-5-[(2-methoxyethylamino)methyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CCc1nc(N(C)CC)sc1CNCCOC |
| InChI | InChI=1S/C12H23N3OS/c1-5-10-11(9-13-7-8-16-4)17-12(14-10)15(3)6-2/h13H,5-9H2,1-4H3 |
| InChIKey | UZDXIWQVKHZMKZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|