C12H17N3O3 — CID 55118344
5-amino-1-[2-(3-methylmorpholin-4-yl)-2-oxoethyl]pyridin-2-one (PubChem CID 55118344) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-amino-1-[2-(3-methylmorpholin-4-yl)-2-oxoethyl]pyridin-2-one.
| Compound Name | 5-amino-1-[2-(3-methylmorpholin-4-yl)-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 55118344 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-amino-1-[2-(3-methylmorpholin-4-yl)-2-oxoethyl]pyridin-2-one |
| SMILES | CC1COCCN1C(=O)Cn1cc(N)ccc1=O |
| InChI | InChI=1S/C12H17N3O3/c1-9-8-18-5-4-15(9)12(17)7-14-6-10(13)2-3-11(14)16/h2-3,6,9H,4-5,7-8,13H2,1H3 |
| InChIKey | NWIZIRPPWYEOIG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |