C13H12F3NOS — CID 55118351
2,4,5-trifluoro-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]aniline (PubChem CID 55118351) has the molecular formula C13H12F3NOS and a molecular weight of 287.31 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]aniline.
| Compound Name | 2,4,5-trifluoro-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 55118351 |
| Molecular Formula | C13H12F3NOS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2,4,5-trifluoro-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]aniline |
| SMILES | CSCc1ccc(CNc2cc(F)c(F)cc2F)o1 |
| InChI | InChI=1S/C13H12F3NOS/c1-19-7-9-3-2-8(18-9)6-17-13-5-11(15)10(14)4-12(13)16/h2-5,17H,6-7H2,1H3 |
| InChIKey | ZSLLPJLZQQFGPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|