C14H16FN3O — CID 55118976
6-ethoxy-2-N-(4-fluoro-3-methylphenyl)pyridine-2,5-diamine (PubChem CID 55118976) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 6-ethoxy-2-N-(4-fluoro-3-methylphenyl)pyridine-2,5-diamine.
| Compound Name | 6-ethoxy-2-N-(4-fluoro-3-methylphenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 55118976 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6-ethoxy-2-N-(4-fluoro-3-methylphenyl)pyridine-2,5-diamine |
| SMILES | CCOc1nc(Nc2ccc(F)c(C)c2)ccc1N |
| InChI | InChI=1S/C14H16FN3O/c1-3-19-14-12(16)6-7-13(18-14)17-10-4-5-11(15)9(2)8-10/h4-8H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | GZTBBHJXZILMBA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |