C14H17F3N2 — CID 55119473
9-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 55119473) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 9-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | 9-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 55119473 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 9-(3,4,5-trifluorophenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | NC1CC2CCCC(C1)N2c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H17F3N2/c15-12-6-11(7-13(16)14(12)17)19-9-2-1-3-10(19)5-8(18)4-9/h6-10H,1-5,18H2 |
| InChIKey | FDPNIDJBVHYTHW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|